Difference between revisions of "PWY-7767"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8973 CPD-8973] == * smiles: ** COP(OC1(=CC=C(C=C1)[N+](=O)[O-]))(OC)=S * common name: ** me...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7767 PWY-7767] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7767 PWY-7767] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
− | ** | + | ** leucine degradation IV |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''1''' reactions found over '''5''' reactions in the full pathway |
− | == Reaction(s) | + | * [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]] |
− | == | + | ** 2 associated gene(s): |
+ | *** [[Tiso_gene_18403]] | ||
+ | *** [[Tiso_gene_14984]] | ||
+ | ** 5 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16245 RXN-16245] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16246 RXN-16246] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16247 RXN-16247] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17524 RXN-17524] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=leucine degradation IV}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=20.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:34, 21 March 2018
Pathway PWY-7767
- taxonomic range:
- common name:
- leucine degradation IV
- Synonym(s):
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- BRANCHED-CHAINAMINOTRANSFERLEU-RXN
- 2 associated gene(s):
- 5 reconstruction source(s) associated: