Difference between revisions of "PWY-882"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-369 CPD-369] == * smiles: ** C(C(C(C(C(O)CO)O)O)O)O * common name: ** L-iditol * inchi key:...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-369 CPD-369] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882] ==
−
* smiles:
+
* taxonomic range:
−
** C(C(C(C(C(O)CO)O)O)O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
−
** L-iditol
+
** L-ascorbate biosynthesis I (L-galactose pathway)
−
* inchi key:
+
−
** InChIKey=FBPFZTCFMRRESA-UNTFVMJOSA-N
+
−
* molecular weight:
+
−
** 182.173   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** vitamin C biosynthesis
 +
** ascorbic acid biosynthesis
 +
** L-ascorbic acid biosynthesis I
 +
** Smirnoff-Wheeler pathway
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''6''' reactions found over '''8''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[2.7.7.13-RXN]]
−
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_14704]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-synechocystis]]
 +
* [[GALACTONOLACTONE-DEHYDROGENASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_210]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[PHOSMANMUT-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_5802]]
 +
*** [[Tiso_gene_13477]]
 +
*** [[Tiso_gene_14704]]
 +
*** [[Tiso_gene_4816]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-creinhardtii]]
 +
* [[RXN-1882]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_6621]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-1884]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_14920]]
 +
*** [[Tiso_gene_14624]]
 +
*** [[Tiso_gene_18748]]
 +
*** [[Tiso_gene_703]]
 +
*** [[Tiso_gene_4219]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXNQT-4142]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_11614]]
 +
*** [[Tiso_gene_10754]]
 +
*** [[Tiso_gene_15599]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=MANNPISOM-RXN MANNPISOM-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4141 RXNQT-4141]
 
== External links  ==
 
== External links  ==
−
* CAS : 488-45-9
+
* ARACYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-882 PWY-882]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460044 5460044]
+
{{#set: taxonomic range=TAX-33090}}
−
* HMDB : HMDB11632
+
{{#set: common name=L-ascorbate biosynthesis I (L-galactose pathway)}}
−
* LIGAND-CPD:
+
{{#set: common name=vitamin C biosynthesis|ascorbic acid biosynthesis|L-ascorbic acid biosynthesis I|Smirnoff-Wheeler pathway}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01507 C01507]
+
{{#set: reaction found=6}}
−
* CHEMSPIDER:
+
{{#set: total reaction=8}}
−
** [http://www.chemspider.com/Chemical-Structure.4573729.html 4573729]
+
{{#set: completion rate=75.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18202 18202]
+
−
* METABOLIGHTS : MTBLC18202
+
−
{{#set: smiles=C(C(C(C(C(O)CO)O)O)O)O}}
+
−
{{#set: common name=L-iditol}}
+
−
{{#set: inchi key=InChIKey=FBPFZTCFMRRESA-UNTFVMJOSA-N}}
+
−
{{#set: molecular weight=182.173    }}
+
−
{{#set: reversible reaction associated=L-IDITOL-2-DEHYDROGENASE-RXN}}
+

Latest revision as of 20:37, 21 March 2018

Pathway PWY-882

  • taxonomic range:
  • common name:
    • L-ascorbate biosynthesis I (L-galactose pathway)
  • Synonym(s):
    • vitamin C biosynthesis
    • ascorbic acid biosynthesis
    • L-ascorbic acid biosynthesis I
    • Smirnoff-Wheeler pathway

Reaction(s) found

6 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-882&oldid=42801"