Difference between revisions of "PWY0-1507"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * common name: ** L-gulona...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1507 PWY0-1507] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1507 PWY0-1507] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
* common name: | * common name: | ||
| − | ** | + | ** biotin biosynthesis from 8-amino-7-oxononanoate I |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** biotin biosynthesis from 7-keto-8-aminopelargonate |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''3''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[2.8.1.6-RXN]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Tiso_gene_10345]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[DAPASYN-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_11635]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[DETHIOBIOTIN-SYN-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_11635]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1507 PWY0-1507] |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=biotin biosynthesis from 8-amino-7-oxononanoate I}} | |
| − | + | {{#set: common name=biotin biosynthesis from 7-keto-8-aminopelargonate}} | |
| − | + | {{#set: reaction found=3}} | |
| − | + | {{#set: total reaction=3}} | |
| − | {{#set: | + | {{#set: completion rate=100.0}} |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:08, 21 March 2018
Pathway PWY0-1507
- taxonomic range:
- common name:
- biotin biosynthesis from 8-amino-7-oxononanoate I
- Synonym(s):
- biotin biosynthesis from 7-keto-8-aminopelargonate
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- 2.8.1.6-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- DAPASYN-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- DETHIOBIOTIN-SYN-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
