Difference between revisions of "PWYG-321"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] == * smiles: ** C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O * in...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6976 PWY-6976] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6976 PWY-6976] ==
−
* smiles:
+
* taxonomic range:
−
** C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=PJRXVIJAERNUIP-VKHMYHEASA-L
+
 
* common name:
 
* common name:
−
** γ-L-glutamyl 5-phosphate
+
** dTDP-L-mycarose biosynthesis
−
* molecular weight:
+
−
** 225.094   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-glutamate 5-phosphate
 
−
** γ-L-glutamyl-5-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[G5DH]]
+
'''2''' reactions found over '''7''' reactions in the full pathway
−
* [[GLUTSEMIALDEHYDROG-RXN]]
+
* [[DTDPGLUCDEHYDRAT-RXN]]
−
* [[G5DHm]]
+
** 2 associated gene(s):
−
== Reaction(s) known to produce the compound ==
+
*** [[Tiso_gene_7329]]
−
* [[GLUTKIN-RXN]]
+
*** [[Tiso_gene_12394]]
−
== Reaction(s) of unknown directionality ==
+
** 4 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[DTDPGLUCOSEPP-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_14704]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-synechocystis]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12404 RXN-12404]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12935 RXN-12935]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12940 RXN-12940]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12941 RXN-12941]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12942 RXN-12942]
 
== External links  ==
 
== External links  ==
−
* BIGG : glu5p
+
{{#set: taxonomic range=TAX-2}}
−
* PUBCHEM:
+
{{#set: common name=dTDP-L-mycarose biosynthesis}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44457531 44457531]
+
{{#set: reaction found=2}}
−
* HMDB : HMDB01228
+
{{#set: total reaction=7}}
−
* LIGAND-CPD:
+
{{#set: completion rate=29.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03287 C03287]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58274 58274]
+
−
* METABOLIGHTS : MTBLC58274
+
−
{{#set: smiles=C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O}}
+
−
{{#set: inchi key=InChIKey=PJRXVIJAERNUIP-VKHMYHEASA-L}}
+
−
{{#set: common name=γ-L-glutamyl 5-phosphate}}
+
−
{{#set: molecular weight=225.094    }}
+
−
{{#set: common name=L-glutamate 5-phosphate|γ-L-glutamyl-5-P}}
+
−
{{#set: consumed by=G5DH|GLUTSEMIALDEHYDROG-RXN|G5DHm}}
+
−
{{#set: produced by=GLUTKIN-RXN}}
+

Revision as of 16:01, 21 March 2018

Pathway PWY-6976

  • taxonomic range:
  • common name:
    • dTDP-L-mycarose biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWYG-321&oldid=31913"