Difference between revisions of "PWYQT-4427"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * smiles: ** C12(NC(=O)NC=1C(=O)NC(=O)N2) * inchi key: ** InChIKey=LEHOTFFKMJEO...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4427 PWYQT-4427] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4427 PWYQT-4427] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33634 TAX-33634] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] | ||
* common name: | * common name: | ||
− | ** | + | ** sulfoquinovosyl diacylglycerol biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** SQDG biosynthesis |
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''2''' reactions found over '''2''' reactions in the full pathway | |
− | * [[ | + | * [[RXN-1223]] |
− | + | ** 1 associated gene(s): | |
− | * [[ | + | *** [[Tiso_gene_2295]] |
− | * [[ | + | ** 4 reconstruction source(s) associated: |
− | * [[ | + | *** [[orthology-athaliana]] |
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-1224]] | ||
+ | ** 11 associated gene(s): | ||
+ | *** [[Tiso_gene_7966]] | ||
+ | *** [[Tiso_gene_17894]] | ||
+ | *** [[Tiso_gene_12341]] | ||
+ | *** [[Tiso_gene_11792]] | ||
+ | *** [[Tiso_gene_9428]] | ||
+ | *** [[Tiso_gene_10734]] | ||
+ | *** [[Tiso_gene_412]] | ||
+ | *** [[Tiso_gene_3385]] | ||
+ | *** [[Tiso_gene_19034]] | ||
+ | *** [[Tiso_gene_10863]] | ||
+ | *** [[Tiso_gene_15050]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-33634}} | |
− | + | {{#set: taxonomic range=TAX-2763}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=sulfoquinovosyl diacylglycerol biosynthesis}} | |
− | + | {{#set: common name=SQDG biosynthesis}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=2}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:22, 21 March 2018
Pathway PWYQT-4427
- taxonomic range:
- common name:
- sulfoquinovosyl diacylglycerol biosynthesis
- Synonym(s):
- SQDG biosynthesis
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- RXN-1223
- 1 associated gene(s):
- 4 reconstruction source(s) associated:
- RXN-1224
- 11 associated gene(s):
- 1 reconstruction source(s) associated: