Difference between revisions of "R05068"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYLCHLOROPHYLLIDE-A DIVINYLCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R05068 R05068] == * direction: ** LEFT-TO-RIGHT * common name: ** R289 * Synonym(s): == Reaction F...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYLCHLOROPHYLLIDE-A DIVINYLCHLOROPHYLLIDE-A] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R05068 R05068] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 3,8-divinyl chlorophyllide a
+
** R289
−
* molecular weight:
+
−
** 610.951   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-5286]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CPD-15104]][c] '''+''' 1.0 [[NADPH]][c] '''+''' 1.0 [[PROTON]][c] '''=>''' 1.0 [[NADP]][c] '''+''' 1.0 [[1-KETO-2-METHYLVALERATE]][c]
−
* [[RXN-5285]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 (R)-3-hydroxy-3-methyl-2-oxopentanoate[c] '''+''' 1.0 NADPH[c] '''+''' 1.0 H+[c] '''=>''' 1.0 NADP+[c] '''+''' 1.0 (R)-2,3-dihydroxy-3-methylpentanoate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10174]]
 +
** Source: [[orthology-synechocystis]]
 +
* Gene: [[Tiso_gene_10173]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927710 56927710]
+
{{#set: common name=R289}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_10174|Tiso_gene_10173}}
−
** [http://www.chemspider.com/Chemical-Structure.391650.html 391650]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38259 38259]
+
{{#set: reconstruction source=orthology-synechocystis}}
−
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11832 C11832]
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=3,8-divinyl chlorophyllide a}}
+
−
{{#set: molecular weight=610.951    }}
+
−
{{#set: consumed by=RXN-5286}}
+
−
{{#set: produced by=RXN-5285}}
+

Latest revision as of 21:05, 21 March 2018

Reaction R05068

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • R289
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 (R)-3-hydroxy-3-methyl-2-oxopentanoate[c] + 1.0 NADPH[c] + 1.0 H+[c] => 1.0 NADP+[c] + 1.0 (R)-2,3-dihydroxy-3-methylpentanoate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=R05068&oldid=45772"