Difference between revisions of "RFH"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14107 RXN-14107] == * direction: ** LEFT-TO-RIGHT * common name: ** menaquinol-cytochrome c red...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14107 RXN-14107] ==
* smiles:
+
* direction:
** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J
+
 
* common name:
 
* common name:
** 3-oxo-(5Z)-dodecenoyl-CoA
+
** menaquinol-cytochrome c reductase
* molecular weight:
+
** cytochrome_b6-fcomplexiron-sulfurchloroplastic
** 957.775   
+
** ubiquinol-cytochrome_c_reductase
 +
** probable_mitochondrial-processingpeptidasesubunitbeta
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.10.2.2 EC-1.10.2.2]
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-12:1-Δ5-CoA
+
** menaquinone:cytochrome c reductase
** 3-oxo-5-cis-dodecenoyl-CoA
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17799]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[Menaquinols]][c] '''+''' 2 [[Cytochromes-C-Oxidized]][e] '''=>''' 1 [[Menaquinones]][c] '''+''' 2 [[Cytochromes-C-Reduced]][e] '''+''' 2 [[PROTON]][c]
* [[RXN-17798]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 a menaquinol[c] '''+''' 2 an oxidized c-type cytochrome[e] '''=>''' 1 a menaquinone[c] '''+''' 2 a reduced c-type cytochrome[e] '''+''' 2 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_9627]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
** EXPERIMENTAL_ANNOTATION
 +
***EC-NUMBER
 +
* [[Tiso_gene_7235]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_4973]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_15926]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
* [[Tiso_gene_18330]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[experimental_annotation]]
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J}}
+
{{#set: common name=menaquinol-cytochrome c reductase}}
{{#set: common name=3-oxo-(5Z)-dodecenoyl-CoA}}
+
{{#set: common name=cytochrome_b6-fcomplexiron-sulfurchloroplastic}}
{{#set: molecular weight=957.775    }}
+
{{#set: common name=ubiquinol-cytochrome_c_reductase}}
{{#set: common name=3-oxo-12:1-Δ5-CoA|3-oxo-5-cis-dodecenoyl-CoA}}
+
{{#set: common name=probable_mitochondrial-processingpeptidasesubunitbeta}}
{{#set: consumed by=RXN-17799}}
+
{{#set: ec number=EC-1.10.2.2}}
{{#set: produced by=RXN-17798}}
+
{{#set: common name=menaquinone:cytochrome c reductase}}
 +
{{#set: gene associated=Tiso_gene_9627|Tiso_gene_7235|Tiso_gene_4973|Tiso_gene_15926|Tiso_gene_18330}}
 +
{{#set: in pathway=}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction tool=pantograph}}
 +
{{#set: reconstruction source=esiliculosus}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}
 +
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}

Revision as of 17:56, 10 January 2018

Reaction RXN-14107

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • menaquinol-cytochrome c reductase
    • cytochrome_b6-fcomplexiron-sulfurchloroplastic
    • ubiquinol-cytochrome_c_reductase
    • probable_mitochondrial-processingpeptidasesubunitbeta
  • ec number:
  • Synonym(s):
    • menaquinone:cytochrome c reductase

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links