Difference between revisions of "RIBOSE-1P"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18607 == * left end position: ** 2 * transcription direction: ** POSITIVE * right end position: ** 2874 * centisome position: ** 6.86106300...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1P RIBOSE-1P] == * smiles: ** C(O)C1(C(O)C(O)C(OP(=O)([O-])[O-])O1) * common name: ** &a...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1P RIBOSE-1P] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C1(C(O)C(O)C(OP(=O)([O-])[O-])O1) |
− | * | + | * common name: |
− | ** | + | ** α-D-ribose-1-phosphate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=YXJDFQJKERBOBM-TXICZTDVSA-L |
− | * | + | * molecular weight: |
− | ** | + | ** 228.095 |
* Synonym(s): | * Synonym(s): | ||
+ | ** D-ribose-1-phosphate | ||
+ | ** α-D-ribose-1P | ||
+ | ** α-D-ribofuranose 1-phosphate | ||
+ | ** ribose-1-phosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[XANTHOSINEPHOSPHORY-RXN]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | * [[URPHOS-RXN]] | |
− | * | + | * [[INOPHOSPHOR-RXN]] |
− | + | * [[RXN-14456]] | |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 58459-37-3 |
− | {{#set: | + | * CAS : 14075-00-4 |
− | {{#set: | + | * BIGG : r1p |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615443 23615443] |
− | {{#set: | + | * HMDB : HMDB01489 |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00620 C00620] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.19951495.html 19951495] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57720 57720] | ||
+ | * METABOLIGHTS : MTBLC57720 | ||
+ | {{#set: smiles=C(O)C1(C(O)C(O)C(OP(=O)([O-])[O-])O1)}} | ||
+ | {{#set: common name=α-D-ribose-1-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=YXJDFQJKERBOBM-TXICZTDVSA-L}} | ||
+ | {{#set: molecular weight=228.095 }} | ||
+ | {{#set: common name=D-ribose-1-phosphate|α-D-ribose-1P|α-D-ribofuranose 1-phosphate|ribose-1-phosphate}} | ||
+ | {{#set: produced by=XANTHOSINEPHOSPHORY-RXN}} | ||
+ | {{#set: reversible reaction associated=URPHOS-RXN|INOPHOSPHOR-RXN|RXN-14456}} |
Latest revision as of 21:07, 21 March 2018
Contents
Metabolite RIBOSE-1P
- smiles:
- C(O)C1(C(O)C(O)C(OP(=O)([O-])[O-])O1)
- common name:
- α-D-ribose-1-phosphate
- inchi key:
- InChIKey=YXJDFQJKERBOBM-TXICZTDVSA-L
- molecular weight:
- 228.095
- Synonym(s):
- D-ribose-1-phosphate
- α-D-ribose-1P
- α-D-ribofuranose 1-phosphate
- ribose-1-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 58459-37-3
- CAS : 14075-00-4
- BIGG : r1p
- PUBCHEM:
- HMDB : HMDB01489
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57720
"C(O)C1(C(O)C(O)C(OP(=O)([O-])[O-])O1)" cannot be used as a page name in this wiki.