Difference between revisions of "RXN-11637"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] == * smiles: ** C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11637 RXN-11637] == * direction: ** LEFT-TO-RIGHT * common name: ** ribosomal_rna_small_subunit...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11637 RXN-11637] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ribosomal_rna_small_subunit_methyltransferase_i |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.1.1.198 EC-2.1.1.198] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[16S-rRNA-cytidine1402]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[16S-rRNA-2-O-methylcytidine1402]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 S-adenosyl-L-methionine[c] '''+''' 1 a cytidine1402 in 16S rRNA[c] '''=>''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 a 2'-O-methylcytidine1402 in 16S rRNA[c] |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_13501]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=ribosomal_rna_small_subunit_methyltransferase_i}} | |
− | + | {{#set: ec number=EC-2.1.1.198}} | |
− | + | {{#set: gene associated=Tiso_gene_13501}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:24, 21 March 2018
Contents
Reaction RXN-11637
- direction:
- LEFT-TO-RIGHT
- common name:
- ribosomal_rna_small_subunit_methyltransferase_i
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 S-ADENOSYLMETHIONINE[c] + 1 16S-rRNA-cytidine1402[c] => 1 PROTON[c] + 1 ADENOSYL-HOMO-CYS[c] + 1 16S-rRNA-2-O-methylcytidine1402[c]
- With common name(s):
- 1 S-adenosyl-L-methionine[c] + 1 a cytidine1402 in 16S rRNA[c] => 1 H+[c] + 1 S-adenosyl-L-homocysteine[c] + 1 a 2'-O-methylcytidine1402 in 16S rRNA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13501
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation