Difference between revisions of "RXN-13290"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6947 CPD-6947] == * smiles: ** CC(CCCC(CCCC(C)CCCC(=CCC2(=CC(=O)C1(C(=CC=CC=1)C(=O)2)))C)C)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-D7-cerotoyl-ACPs trans-D2-cis-D7-cerotoyl-ACPs] == * common name: ** a trans-delta...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6947 CPD-6947] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-D7-cerotoyl-ACPs trans-D2-cis-D7-cerotoyl-ACPs] ==
* smiles:
+
** CC(CCCC(CCCC(C)CCCC(=CCC2(=CC(=O)C1(C(=CC=CC=1)C(=O)2)))C)C)C
+
* inchi key:
+
** InChIKey=UDYIPZFWVJJQJF-KQPZCCJBSA-N
+
 
* common name:
 
* common name:
** demethylphylloquinone
+
** a trans-delta2-cis-delta7-C26:2-[acp]
* molecular weight:
+
** 436.676   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-phytyl-1,4-naphtoquinone
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R06859]]
+
* [[RXN1G-37]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R06858]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a trans-delta2-cis-delta7-C26:2-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927684 56927684]
+
{{#set: consumed by=RXN1G-37}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.10128305.html 10128305]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31087 31087]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C13309 C13309]
+
* HMDB : HMDB04649
+
{{#set: smiles=CC(CCCC(CCCC(C)CCCC(=CCC2(=CC(=O)C1(C(=CC=CC=1)C(=O)2)))C)C)C}}
+
{{#set: inchi key=InChIKey=UDYIPZFWVJJQJF-KQPZCCJBSA-N}}
+
{{#set: common name=demethylphylloquinone}}
+
{{#set: molecular weight=436.676    }}
+
{{#set: common name=2-phytyl-1,4-naphtoquinone}}
+
{{#set: consumed by=R06859}}
+
{{#set: produced by=R06858}}
+

Revision as of 15:46, 21 March 2018

Metabolite trans-D2-cis-D7-cerotoyl-ACPs

  • common name:
    • a trans-delta2-cis-delta7-C26:2-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a trans-delta2-cis-delta7-C26:2-[acp" cannot be used as a page name in this wiki.