Difference between revisions of "RXN-13602"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13847 == * left end position: ** 11841 * transcription direction: ** POSITIVE * right end position: ** 13053 * centisome position: ** 88.29...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9924 CPD-9924] == * smiles: ** C=C(C(=O)[O-])OC1(CC=C(C(=O)CCC(=O)[O-])C(C(O)1)C(=O)[O-]) *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9924 CPD-9924] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=C(C(=O)[O-])OC1(CC=C(C(=O)CCC(=O)[O-])C(C(O)1)C(=O)[O-]) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JKJGLRGLOMRXFN-MVWJERBFSA-K |
| − | * | + | * common name: |
| − | ** | + | ** 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 325.251 |
* Synonym(s): | * Synonym(s): | ||
| + | ** SEPHCHC | ||
| + | ** 5-enolpyruvoyl-6-hydroxy-2-succinyl-cyclohex-3-ene-1-carboxylate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-9310]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[2.5.1.64-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657446 90657446] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50271 50271] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16519 C16519] |
| + | {{#set: smiles=C=C(C(=O)[O-])OC1(CC=C(C(=O)CCC(=O)[O-])C(C(O)1)C(=O)[O-])}} | ||
| + | {{#set: inchi key=InChIKey=JKJGLRGLOMRXFN-MVWJERBFSA-K}} | ||
| + | {{#set: common name=2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate}} | ||
| + | {{#set: molecular weight=325.251 }} | ||
| + | {{#set: common name=SEPHCHC|5-enolpyruvoyl-6-hydroxy-2-succinyl-cyclohex-3-ene-1-carboxylate}} | ||
| + | {{#set: consumed by=RXN-9310}} | ||
| + | {{#set: produced by=2.5.1.64-RXN}} | ||
Revision as of 19:37, 18 March 2018
Contents
Metabolite CPD-9924
- smiles:
- C=C(C(=O)[O-])OC1(CC=C(C(=O)CCC(=O)[O-])C(C(O)1)C(=O)[O-])
- inchi key:
- InChIKey=JKJGLRGLOMRXFN-MVWJERBFSA-K
- common name:
- 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate
- molecular weight:
- 325.251
- Synonym(s):
- SEPHCHC
- 5-enolpyruvoyl-6-hydroxy-2-succinyl-cyclohex-3-ene-1-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(C(=O)[O-])OC1(CC=C(C(=O)CCC(=O)[O-])C(C(O)1)C(=O)[O-])" cannot be used as a page name in this wiki.
