Difference between revisions of "RXN-14106"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE N-ACETYL-D-GLUCOSAMINE] == * smiles: ** CC(=O)NC1(C(O)OC(CO)C(O)C(O)1) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14106 RXN-14106] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/5.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14106 RXN-14106] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/5.4.99.3 EC-5.4.99.3] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[2-ACETO-2-HYDROXY-BUTYRATE]][c] '''<=>''' 1 [[CPD-15104]][c] |
− | == | + | * With common name(s): |
+ | ** 1 (S)-2-aceto-2-hydroxybutanoate[c] '''<=>''' 1 (R)-3-hydroxy-3-methyl-2-oxopentanoate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_10173]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_10174]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25407 25407] | |
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: ec number=EC-5.4.99.3}} | |
− | + | {{#set: gene associated=Tiso_gene_10173|Tiso_gene_10174}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii|orthology-synechocystis}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | ** [http://www.ebi.ac.uk/ | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:38, 21 March 2018
Contents
Reaction RXN-14106
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 2-ACETO-2-HYDROXY-BUTYRATE[c] <=> 1 CPD-15104[c]
- With common name(s):
- 1 (S)-2-aceto-2-hydroxybutanoate[c] <=> 1 (R)-3-hydroxy-3-methyl-2-oxopentanoate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10173
- Source: orthology-synechocystis
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii
- Gene: Tiso_gene_10174
- Source: orthology-synechocystis
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-creinhardtii
External links
- RHEA: