Difference between revisions of "RXN-14284"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2108 CPD0-2108] == * smiles: ** CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-]...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14284 RXN-14284] == * direction: ** LEFT-TO-RIGHT * common name: ** thymidine_phosphorylase * e...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2108 CPD0-2108] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14284 RXN-14284] ==
−
* smiles:
+
* direction:
−
** CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** trans-oct-2-enoyl-CoA
+
** thymidine_phosphorylase
−
* inchi key:
+
* ec number:
−
** InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J
+
** [http://enzyme.expasy.org/EC/2.4.1.1 EC-2.4.1.1]
−
* molecular weight:
+
−
** 887.685   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (2E)-octenoyl-CoA
 
−
** trans-2-octenoyl-coenzyme A
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14276]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[MALTOPENTAOSE]][c] '''+''' 1 [[Pi]][c] '''=>''' 1 [[GLC-1-P]][c] '''+''' 1 [[MALTOTETRAOSE]][c]
−
* [[RXN-12669]]
+
* With common name(s):
−
* [[ACOA80or]]
+
** 1 maltopentaose[c] '''+''' 1 phosphate[c] '''=>''' 1 α-D-glucopyranose 1-phosphate[c] '''+''' 1 maltotetraose[c]
−
== Reaction(s) of unknown directionality ==
+
 
−
* [[RXN-14229]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_1011]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05276 C05276]
+
{{#set: common name=thymidine_phosphorylase}}
−
* HMDB : HMDB03949
+
{{#set: ec number=EC-2.4.1.1}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_1011}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62242 62242]
+
{{#set: in pathway=}}
−
* BIGG : oc2coa
+
{{#set: reconstruction category=annotation}}
−
* PUBCHEM:
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173358 46173358]
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}}
+
−
{{#set: common name=trans-oct-2-enoyl-CoA}}
+
−
{{#set: inchi key=InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J}}
+
−
{{#set: molecular weight=887.685    }}
+
−
{{#set: common name=(2E)-octenoyl-CoA|trans-2-octenoyl-coenzyme A}}
+
−
{{#set: consumed by=RXN-14276}}
+
−
{{#set: produced by=RXN-12669|ACOA80or}}
+
−
{{#set: reversible reaction associated=RXN-14229}}
+

Latest revision as of 20:52, 21 March 2018

Reaction RXN-14284

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • thymidine_phosphorylase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 maltopentaose[c] + 1 phosphate[c] => 1 α-D-glucopyranose 1-phosphate[c] + 1 maltotetraose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14284&oldid=44283"