Difference between revisions of "RXN-14394"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NADH/PROTON.42. RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NAD...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NADH/PROTON.42. RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NADH/PROTON.42.] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | + | ||
− | + | ||
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1.0 [[CPD-14719]][c] '''+''' 1.0 [[WATER]][c] '''+''' 1.0 [[NAD]][c] '''=>''' 2.0 [[PROTON]][c] '''+''' 1.0 [[NADH]][c] '''+''' 1.0 [[CPD-7830]][c] |
− | == | + | * With common name(s): |
+ | ** 1.0 heptadecanal[c] '''+''' 1.0 H2O[c] '''+''' 1.0 NAD+[c] '''=>''' 2.0 H+[c] '''+''' 1.0 NADH[c] '''+''' 1.0 heptadecanoate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[gap-filling]] | ||
+ | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | *** Tool: [[meneco]] | ||
+ | **** Comment: [[added for gapfilling]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: in pathway=}} | |
− | {{#set: | + | {{#set: reconstruction category=gap-filling}} |
− | {{#set: | + | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} |
− | {{#set: | + | {{#set: reconstruction tool=meneco}} |
− | {{#set: | + | {{#set: reconstruction comment=added for gapfilling}} |
− | {{#set: | + |
Revision as of 16:35, 21 March 2018
Contents
Reaction RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NADH/PROTON.42.
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 heptadecanal[c] + 1.0 H2O[c] + 1.0 NAD+[c] => 2.0 H+[c] + 1.0 NADH[c] + 1.0 heptadecanoate[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: gap-filling
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
- Tool: meneco
- Comment: added for gapfilling
- Tool: meneco
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium