Difference between revisions of "RXN-14394"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14394 RXN-14394] == * direction: ** LEFT-TO-RIGHT * common name: ** acetyl-_c-acetyltransferase...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14394 RXN-14394] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** acetyl-_c-acetyltransferase |
− | * | + | ** 3-ketoacyl-_thiolase |
− | ** | + | ** thiolase |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/2.3.1.16 EC-2.3.1.16] | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[CPD-15244]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[CPD-7221]][c] |
− | == | + | * With common name(s): |
+ | ** 1 3-oxo-(5Z)-tetradecenoyl-CoA[c] '''+''' 1 coenzyme A[c] '''=>''' 1 acetyl-CoA[c] '''+''' 1 3-cis-dodecenoyl-CoA[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_10116]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_15327]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_17451]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_3856]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_3855]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=acetyl-_c-acetyltransferase}} | |
− | {{#set: | + | {{#set: common name=3-ketoacyl-_thiolase}} |
− | {{#set: | + | {{#set: common name=thiolase}} |
− | {{#set: common name= | + | {{#set: ec number=EC-2.3.1.16}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_10116|Tiso_gene_15327|Tiso_gene_17451|Tiso_gene_3856|Tiso_gene_3855}} |
− | {{#set: | + | {{#set: in pathway=}} |
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:54, 21 March 2018
Contents
Reaction RXN-14394
- direction:
- LEFT-TO-RIGHT
- common name:
- acetyl-_c-acetyltransferase
- 3-ketoacyl-_thiolase
- thiolase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-15244[c] + 1 CO-A[c] => 1 ACETYL-COA[c] + 1 CPD-7221[c]
- With common name(s):
- 1 3-oxo-(5Z)-tetradecenoyl-CoA[c] + 1 coenzyme A[c] => 1 acetyl-CoA[c] + 1 3-cis-dodecenoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10116
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_15327
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_17451
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_3856
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_3855
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation