Difference between revisions of "RXN-16415"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] == * smiles: ** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O * inchi key: ** InChIKey=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16415 RXN-16415] == * direction: ** REVERSIBLE * common name: ** polyketide_synthase ** long_ch...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16415 RXN-16415] ==
−
* smiles:
+
* direction:
−
** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** tributyrin
+
** polyketide_synthase
−
* molecular weight:
+
** long_chain_acyl-_synthetase
−
** 302.367   
+
** acyl-_synthetase
 +
** ORF
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
−
** butyryl triglyceride
 
−
** butanoic acid, 1,2,3-propanetriyl ester
 
−
** 1,2,3-tributyrylglycerol
 
−
** tributin
 
−
** tributyrinine
 
−
** glycerol tributyrate
 
−
** glyceryl tributyrate
 
−
** butyrin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12086]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CO-A]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[Very-long-chain-fatty-acids]][c] '''<=>''' 1 [[VERY-LONG-CHAIN-FATTY-ACYL-COA]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 coenzyme A[c] '''+''' 1 ATP[c] '''+''' 1 a very-long-chain fatty acid[c] '''<=>''' 1 a very long chain fatty acyl-CoA[c] '''+''' 1 diphosphate[c] '''+''' 1 AMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_135]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_7855]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4191]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_9394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_348]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10876]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C13870 C13870]
+
{{#set: common name=polyketide_synthase}}
−
* CHEMSPIDER:
+
{{#set: common name=long_chain_acyl-_synthetase}}
−
** [http://www.chemspider.com/Chemical-Structure.13849665.html 13849665]
+
{{#set: common name=acyl-_synthetase}}
−
* CHEBI:
+
{{#set: common name=ORF}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35020 35020]
+
{{#set: ec number=EC-6.2.1.3}}
−
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_500|Tiso_gene_135|Tiso_gene_7855|Tiso_gene_4191|Tiso_gene_13394|Tiso_gene_136|Tiso_gene_9394|Tiso_gene_348|Tiso_gene_10876}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6050 6050]
+
{{#set: in pathway=}}
−
* HMDB : HMDB31094
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
{{#set: inchi key=InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=tributyrin}}
+
−
{{#set: molecular weight=302.367    }}
+
−
{{#set: common name=butyryl triglyceride|butanoic acid, 1,2,3-propanetriyl ester|1,2,3-tributyrylglycerol|tributin|tributyrinine|glycerol tributyrate|glyceryl tributyrate|butyrin}}
+
−
{{#set: consumed by=RXN-12086}}
+

Latest revision as of 21:22, 21 March 2018

Reaction RXN-16415

  • direction:
    • REVERSIBLE
  • common name:
    • polyketide_synthase
    • long_chain_acyl-_synthetase
    • acyl-_synthetase
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-16415&oldid=48265"