Difference between revisions of "RXN-16418"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5821 CPD-5821] == * smiles: ** C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16418 RXN-16418] == * direction: ** LEFT-TO-RIGHT * common name: ** polyketide_synthase ** ORF...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16418 RXN-16418] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** polyketide_synthase |
− | * | + | ** ORF |
− | ** | + | ** long_chain_acyl-_synthetase |
+ | ** acyl-_synthetase | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[ATP]][c] '''+''' 1 [[OCTADEC-9-ENE-118-DIOIC-ACID]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[CPD-17624]][c] '''+''' 1 [[PPI]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 ATP[c] '''+''' 1 α,ω-9Z-octadecenedioate[c] '''+''' 1 coenzyme A[c] '''=>''' 1 AMP[c] '''+''' 1 ω-carboxy-(9Z)-octadec-9-enoyl-CoA[c] '''+''' 1 diphosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_500]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_135]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_13394]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_10876]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_7855]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_9394]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_136]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_348]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_4191]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-1121]], suberin monomers biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1121 PWY-1121] | ||
+ | ** '''9''' reactions found over '''19''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=polyketide_synthase}} | |
− | + | {{#set: common name=ORF}} | |
− | + | {{#set: common name=long_chain_acyl-_synthetase}} | |
− | + | {{#set: common name=acyl-_synthetase}} | |
− | + | {{#set: ec number=EC-6.2.1.3}} | |
− | + | {{#set: gene associated=Tiso_gene_500|Tiso_gene_135|Tiso_gene_13394|Tiso_gene_10876|Tiso_gene_7855|Tiso_gene_9394|Tiso_gene_136|Tiso_gene_348|Tiso_gene_4191}} | |
− | + | {{#set: in pathway=PWY-1121}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:02, 21 March 2018
Contents
Reaction RXN-16418
- direction:
- LEFT-TO-RIGHT
- common name:
- polyketide_synthase
- ORF
- long_chain_acyl-_synthetase
- acyl-_synthetase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 ATP[c] + 1 α,ω-9Z-octadecenedioate[c] + 1 coenzyme A[c] => 1 AMP[c] + 1 ω-carboxy-(9Z)-octadec-9-enoyl-CoA[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_500
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_135
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_13394
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_10876
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_7855
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_9394
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_136
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_348
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_4191
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-1121, suberin monomers biosynthesis: PWY-1121
- 9 reactions found over 19 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation