Difference between revisions of "RXN-16602"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M 131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M] == * smiles:...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16602 RXN-16602] == * direction: ** LEFT-TO-RIGHT * common name: ** dolichol_phosphate_mannose...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M 131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16602 RXN-16602] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester
+
** dolichol_phosphate_mannose
−
* molecular weight:
+
* ec number:
−
** 611.959   
+
** [http://enzyme.expasy.org/EC/2.4.1.83 EC-2.4.1.83]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-5284]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-17858]][c] '''+''' 1 [[GDP-MANNOSE]][c] '''=>''' 1 [[GDP]][c] '''+''' 1 [[CPD-17894]][c]
−
* [[RXN-5283]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 ω-saturated C55 dolichol phosphate[c] '''+''' 1 GDP-α-D-mannose[c] '''=>''' 1 GDP[c] '''+''' 1 β-D-mannosyl-(C55 ω-saturated dolichyl phosphate)[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_16772]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7661]], protein N-glycosylation (Haloferax volcanii): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7661 PWY-7661]
 +
** '''1''' reactions found over '''10''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658440 90658440]
+
{{#set: common name=dolichol_phosphate_mannose}}
−
* CHEBI:
+
{{#set: ec number=EC-2.4.1.83}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60490 60490]
+
{{#set: gene associated=Tiso_gene_16772}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-7661}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11830 C11830]
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: common name=131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=611.959    }}
+
−
{{#set: consumed by=RXN-5284}}
+
−
{{#set: produced by=RXN-5283}}
+

Latest revision as of 21:25, 21 March 2018

Reaction RXN-16602

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • dolichol_phosphate_mannose
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ω-saturated C55 dolichol phosphate[c] + 1 GDP-α-D-mannose[c] => 1 GDP[c] + 1 β-D-mannosyl-(C55 ω-saturated dolichyl phosphate)[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7661, protein N-glycosylation (Haloferax volcanii): PWY-7661
    • 1 reactions found over 10 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-16602&oldid=48676"