Difference between revisions of "RXN-1826"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * inc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-2Fe-2S-Ferredoxins Reduced-2Fe-2S-Ferredoxins] == * common name: ** a reduced [2Fe-2S]...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-2Fe-2S-Ferredoxins Reduced-2Fe-2S-Ferredoxins] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a reduced [2Fe-2S] ferredoxin |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14950]] | ||
| + | * [[RXN-14957]] | ||
| + | * [[RXN-14959]] | ||
| + | * [[RXN-17472]] | ||
| + | * [[RXN0-949]] | ||
| + | * [[2.8.1.6-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a reduced [2Fe-2S] ferredoxin}} | |
| − | + | {{#set: consumed by=RXN-14950|RXN-14957|RXN-14959|RXN-17472|RXN0-949|2.8.1.6-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 15:49, 21 March 2018
Contents
Metabolite Reduced-2Fe-2S-Ferredoxins
- common name:
- a reduced [2Fe-2S] ferredoxin
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a reduced [2Fe-2S] ferredoxin" cannot be used as a page name in this wiki.
