Difference between revisions of "RXN-9540"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SCOPOLETIN SCOPOLETIN] == * smiles: ** COC2(C=C1(C(OC(=O)C=C1)=CC=2O)) * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UG6PGTn UG6PGTn] == * direction: ** LEFT-TO-RIGHT * common name: ** UDPglucose:D-glucose-6-phosphat...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UG6PGTn UG6PGTn] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** UDPglucose:D-glucose-6-phosphate 1-alpha-D-glucosyltransferase, nucleus |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1.0 [[CPD-12575]][n] '''+''' 1.0 [[ALPHA-GLC-6-P]][n] '''=>''' 1.0 [[UDP]][n] '''+''' 1.0 [[TREHALOSE-6P]][n] '''+''' 1.0 [[PROTON]][n] |
− | == | + | * With common name(s): |
+ | ** 1.0 UDP-α-D-glucose[n] '''+''' 1.0 α-D-glucose 6-phosphate[n] '''=>''' 1.0 UDP[n] '''+''' 1.0 α,α-trehalose 6-phosphate[n] '''+''' 1.0 H+[n] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_14220]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_18196]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=UDPglucose:D-glucose-6-phosphate 1-alpha-D-glucosyltransferase, nucleus}} | |
− | + | {{#set: gene associated=Tiso_gene_14220|Tiso_gene_18196}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:39, 21 March 2018
Contents
Reaction UG6PGTn
- direction:
- LEFT-TO-RIGHT
- common name:
- UDPglucose:D-glucose-6-phosphate 1-alpha-D-glucosyltransferase, nucleus
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 CPD-12575[n] + 1.0 ALPHA-GLC-6-P[n] => 1.0 UDP[n] + 1.0 TREHALOSE-6P[n] + 1.0 PROTON[n]
- With common name(s):
- 1.0 UDP-α-D-glucose[n] + 1.0 α-D-glucose 6-phosphate[n] => 1.0 UDP[n] + 1.0 α,α-trehalose 6-phosphate[n] + 1.0 H+[n]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14220
- Source: orthology-creinhardtii
- Gene: Tiso_gene_18196
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii