Difference between revisions of "RXN-9540"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9540 RXN-9540] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-palmitoyl-[acyl-carrier...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9540 RXN-9540] ==
−
* smiles:
+
* direction:
−
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N
+
 
* common name:
 
* common name:
−
** (5α)-campestan-3-one
+
** 3-oxo-palmitoyl-[acyl-carrier protein] reductase
−
* molecular weight:
+
** polyketide_synthase
−
** 400.687   
+
** 3-oxoacyl-(acyl-carrier-protein)
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
 +
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
 +
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
 
* Synonym(s):
 
* Synonym(s):
−
** methylcholestanone
 
−
** (24R)-24-methyl-5α-cholestan-3-one
 
−
** 3-dehydro-campestanol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-4230]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NADPH]][c] '''+''' 1 [[3-oxo-palmitoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[R-3-Hydroxypalmitoyl-ACPs]][c]
−
* [[RXN-711]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 NADPH[c] '''+''' 1 a 3-oxo-palmitoyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 a (3R)-3-hydroxypalmitoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9885]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13083]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_10876]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_135]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061343 16061343]
+
{{#set: common name=3-oxo-palmitoyl-[acyl-carrier protein] reductase}}
−
* CHEBI:
+
{{#set: common name=polyketide_synthase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18533 18533]
+
{{#set: common name=3-oxoacyl-(acyl-carrier-protein)}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-2.3.1.86}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15786 C15786]
+
{{#set: ec number=EC-2.3.1.85}}
−
* HMDB : HMDB12116
+
{{#set: ec number=EC-1.1.1.100}}
−
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: gene associated=Tiso_gene_9885|Tiso_gene_13083|Tiso_gene_10876|Tiso_gene_135|Tiso_gene_13394|Tiso_gene_136|Tiso_gene_500}}
−
{{#set: inchi key=InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N}}
+
{{#set: in pathway=PWY-5971|PWY-5994}}
−
{{#set: common name=(5α)-campestan-3-one}}
+
{{#set: reconstruction category=orthology|manual|annotation}}
−
{{#set: molecular weight=400.687    }}
+
{{#set: reconstruction source=annotation-experimental_annotation|manual-primary_network|annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: common name=methylcholestanone|(24R)-24-methyl-5α-cholestan-3-one|3-dehydro-campestanol}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: consumed by=RXN-4230}}
+
−
{{#set: produced by=RXN-711}}
+

Latest revision as of 20:58, 21 March 2018

Reaction RXN-9540

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxo-palmitoyl-[acyl-carrier protein] reductase
    • polyketide_synthase
    • 3-oxoacyl-(acyl-carrier-protein)
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 31 reactions found over 31 reactions in the full pathway
  • PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"3-oxo-palmitoyl-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-9540&oldid=44983"