Difference between revisions of "RXN-9660"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19205 CPD-19205] == * smiles: ** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-] *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9660 RXN-9660] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-Δ2-decenoyl-[acp]...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9660 RXN-9660] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** trans-Δ2-decenoyl-[acp]-reductase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[Trans-D2-decenoyl-ACPs]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Decanoyl-ACPs]][c] '''+''' 1 [[NAD]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a (2E)-dec-2-enoyl-[acp][c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''=>''' 1 a decanoyl-[acp][c] '''+''' 1 NAD+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_10778]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971] | ||
+ | ** '''31''' reactions found over '''31''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=trans-Δ2-decenoyl-[acp]-reductase}} |
− | {{#set: | + | {{#set: ec number=EC-1.3.1.9}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_10778}} |
− | {{#set: | + | {{#set: in pathway=PWY-5971}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
+ | {{#set: reconstruction source=orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 21:20, 21 March 2018
Contents
Reaction RXN-9660
- direction:
- LEFT-TO-RIGHT
- common name:
- trans-Δ2-decenoyl-[acp]-reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Trans-D2-decenoyl-ACPs[c] + 1 NADH[c] + 1 PROTON[c] => 1 Decanoyl-ACPs[c] + 1 NAD[c]
- With common name(s):
- 1 a (2E)-dec-2-enoyl-[acp][c] + 1 NADH[c] + 1 H+[c] => 1 a decanoyl-[acp][c] + 1 NAD+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10778
- Source: orthology-esiliculosus
Pathways
- PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
- 31 reactions found over 31 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
"trans-Δ2-decenoyl-[acp]-reductase" cannot be used as a page name in this wiki.