Difference between revisions of "RXN0-1401"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == * smiles: ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) * common name:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1401 RXN0-1401] == * direction: ** LEFT-TO-RIGHT * common name: ** thymidine_phosphorylase * e...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1401 RXN0-1401] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** thymidine_phosphorylase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.4.23 EC-2.7.4.23] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[RIBOSE-15-BISPHOSPHATE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PRPP]][c] '''+''' 1 [[ADP]][c] |
− | == | + | * With common name(s): |
+ | ** 1 α-D-ribose 1,5-bisphosphate[c] '''+''' 1 ATP[c] '''=>''' 1 5-phospho-α-D-ribose 1-diphosphate[c] '''+''' 1 ADP[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_1011]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7805]], aminomethylphosphonate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7805 PWY-7805] | ||
+ | ** '''2''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[PWY0-661]], PRPP biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-661 PWY0-661] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-7807]], glyphosate degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7807 PWY-7807] | ||
+ | ** '''2''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20109 20109] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R06836 R06836] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: common name= | + | {{#set: common name=thymidine_phosphorylase}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.4.23}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_1011}} |
− | {{#set: | + | {{#set: in pathway=PWY-7805|PWY0-661|PWY-7807}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
+ | {{#set: reconstruction source=annotation-in-silico_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 21:03, 21 March 2018
Contents
Reaction RXN0-1401
- direction:
- LEFT-TO-RIGHT
- common name:
- thymidine_phosphorylase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 RIBOSE-15-BISPHOSPHATE[c] + 1 ATP[c] => 1 PRPP[c] + 1 ADP[c]
- With common name(s):
- 1 α-D-ribose 1,5-bisphosphate[c] + 1 ATP[c] => 1 5-phospho-α-D-ribose 1-diphosphate[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_1011
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-7805, aminomethylphosphonate degradation: PWY-7805
- 2 reactions found over 8 reactions in the full pathway
- PWY0-661, PRPP biosynthesis II: PWY0-661
- 1 reactions found over 3 reactions in the full pathway
- PWY-7807, glyphosate degradation III: PWY-7807
- 2 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links