Difference between revisions of "RXN0-2381"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2)) * inchi key: ** I...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2381 RXN0-2381] == * direction: ** REVERSIBLE * common name: ** tryptophan_synthase_(alpha_bet...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2381 RXN0-2381] ==
−
* smiles:
+
* direction:
−
** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N
+
 
* common name:
 
* common name:
−
** 7,8-dihydromonapterin
+
** tryptophan_synthase_(alpha_beta_chains)
−
* molecular weight:
+
* ec number:
−
** 255.233   
+
** [http://enzyme.expasy.org/EC/4.1.2.8 EC-4.1.2.8]
 
* Synonym(s):
 
* Synonym(s):
−
** DHM
 
−
** H2-MPt
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[INDOLE-3-GLYCEROL-P]][c] '''<=>''' 1 [[INDOLE]][c] '''+''' 1 [[GAP]][c]
−
* [[RXN-10857]]
+
* With common name(s):
 +
** 1 (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate[c] '''<=>''' 1 indole[c] '''+''' 1 D-glyceraldehyde 3-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_17207]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_4604]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[TRPSYN-PWY]], L-tryptophan biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRPSYN-PWY TRPSYN-PWY]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-6949]], DIBOA-glucoside biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6949 PWY-6949]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* RHEA:
−
** [http://www.genome.jp/dbget-bin/www_bget?C21008 C21008]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14081 14081]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71175 71175]
+
** [http://www.genome.jp/dbget-bin/www_bget?R02340 R02340]
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479435 45479435]
+
{{#set: common name=tryptophan_synthase_(alpha_beta_chains)}}
−
{{#set: smiles=C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2))}}
+
{{#set: ec number=EC-4.1.2.8}}
−
{{#set: inchi key=InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N}}
+
{{#set: gene associated=Tiso_gene_17207|Tiso_gene_4604}}
−
{{#set: common name=7,8-dihydromonapterin}}
+
{{#set: in pathway=TRPSYN-PWY|PWY-6949}}
−
{{#set: molecular weight=255.233    }}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: common name=DHM|H2-MPt}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: consumed or produced by=RXN-10857}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:25, 21 March 2018

Reaction RXN0-2381

  • direction:
    • REVERSIBLE
  • common name:
    • tryptophan_synthase_(alpha_beta_chains)
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate[c] <=> 1 indole[c] + 1 D-glyceraldehyde 3-phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • TRPSYN-PWY, L-tryptophan biosynthesis: TRPSYN-PWY
    • 6 reactions found over 6 reactions in the full pathway
  • PWY-6949, DIBOA-glucoside biosynthesis: PWY-6949
    • 1 reactions found over 6 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN0-2381&oldid=41466"