Difference between revisions of "RXN0-7239"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-HEXANOYL-COA OH-HEXANOYL-COA] == * smiles: ** CCCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7239 RXN0-7239] == * direction: ** LEFT-TO-RIGHT * common name: ** long_chain_acyl-_synthetase...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-HEXANOYL-COA OH-HEXANOYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7239 RXN0-7239] ==
−
* smiles:
+
* direction:
−
** CCCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O)O
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** (S)-3-hydroxyhexanoyl-CoA
+
** long_chain_acyl-_synthetase
−
* inchi key:
+
** polyketide_synthase
−
** InChIKey=VAAHKRMGOFIORX-DWUFXMDISA-J
+
** acyl-_synthetase
−
* molecular weight:
+
** ORF
−
** 877.646   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
−
** OH-hexanoyl-CoA
 
−
** 3-OH-hexanoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-12570]]
+
** 1 [[ATP]][c] '''+''' 1 [[OLEATE-CPD]][e] '''+''' 1 [[PROTON]][e] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[OLEOYL-COA]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 ATP[c] '''+''' 1 oleate[e] '''+''' 1 H+[e] '''+''' 1 coenzyme A[c] '''=>''' 1 H+[c] '''+''' 1 oleoyl-CoA[c] '''+''' 1 diphosphate[c] '''+''' 1 AMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_348]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_9394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_135]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10876]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_7855]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4191]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* BIGG : 3hhcoa
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIPID_MAPS : LMFA07050017
+
{{#set: common name=long_chain_acyl-_synthetase}}
−
* PUBCHEM:
+
{{#set: common name=polyketide_synthase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859661 49859661]
+
{{#set: common name=acyl-_synthetase}}
−
* HMDB : HMDB03942
+
{{#set: common name=ORF}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-6.2.1.3}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05268 C05268]
+
{{#set: gene associated=Tiso_gene_136|Tiso_gene_348|Tiso_gene_9394|Tiso_gene_135|Tiso_gene_500|Tiso_gene_10876|Tiso_gene_13394|Tiso_gene_7855|Tiso_gene_4191}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28276 28276]
+
{{#set: reconstruction category=annotation}}
−
* METABOLIGHTS : MTBLC28276
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
{{#set: smiles=CCCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O)O}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=(S)-3-hydroxyhexanoyl-CoA}}
+
−
{{#set: inchi key=InChIKey=VAAHKRMGOFIORX-DWUFXMDISA-J}}
+
−
{{#set: molecular weight=877.646    }}
+
−
{{#set: common name=OH-hexanoyl-CoA|3-OH-hexanoyl-CoA}}
+
−
{{#set: produced by=RXN-12570}}
+

Latest revision as of 21:12, 21 March 2018

Reaction RXN0-7239

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • long_chain_acyl-_synthetase
    • polyketide_synthase
    • acyl-_synthetase
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 1 oleate[e] + 1 H+[e] + 1 coenzyme A[c] => 1 H+[c] + 1 oleoyl-CoA[c] + 1 diphosphate[c] + 1 AMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN0-7239&oldid=46833"