Difference between revisions of "RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40."

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == * smiles: ** C[S+](CCC([N+])C(=O)[O-])C * inchi key: ** InChIKey=YDBYJHTYSH...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40. RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PR...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40. RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40.] ==
−
* smiles:
+
* direction:
−
** C[S+](CCC([N+])C(=O)[O-])C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O
+
−
* common name:
+
−
** S-methyl-L-methionine
+
−
* molecular weight:
+
−
** 164.242   
+
 
* Synonym(s):
 
* Synonym(s):
−
** S-methylmethionine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[MMUM-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[WATER]][c] '''+''' 1.0 [[CPD-388]][c] '''+''' 1.0 [[NAD]][c] '''=>''' 1.0 [[NADH]][c] '''+''' 2.0 [[PROTON]][c] '''+''' 1.0 [[CPD-8462]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 H2O[c] '''+''' 1.0 pentadecanal[c] '''+''' 1.0 NAD+[c] '''=>''' 1.0 NADH[c] '''+''' 2.0 H+[c] '''+''' 1.0 pentadecanoate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098638 7098638]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=gap-filling}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58252 58252]
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
−
* BIGG : mmet
+
{{#set: reconstruction tool=meneco}}
−
* LIGAND-CPD:
+
{{#set: reconstruction comment=added for gapfilling}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03172 C03172]
+
−
{{#set: smiles=C[S+](CCC([N+])C(=O)[O-])C}}
+
−
{{#set: inchi key=InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O}}
+
−
{{#set: common name=S-methyl-L-methionine}}
+
−
{{#set: molecular weight=164.242    }}
+
−
{{#set: common name=S-methylmethionine}}
+
−
{{#set: consumed by=MMUM-RXN}}
+

Latest revision as of 21:14, 21 March 2018

Reaction RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40.

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H2O[c] + 1.0 pentadecanal[c] + 1.0 NAD+[c] => 1.0 NADH[c] + 2.0 H+[c] + 1.0 pentadecanoate[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40.&oldid=47052"