Difference between revisions of "TRANSENOYLCOARED-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] == * smiles: ** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Tiso_gene_11760 == * right end position: ** 1254 * transcription direction: ** POSITIVE * left end position: ** 307 * centisome position: ** 1.942915...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_11760 == |
− | * | + | * right end position: |
− | ** | + | ** 1254 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 307 |
− | * | + | * centisome position: |
− | ** | + | ** 1.9429151 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[1.1.4.1-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
− | + | == Pathways associated == | |
== External links == | == External links == | ||
− | {{#set: | + | {{#set: right end position=1254}} |
− | {{#set: | + | {{#set: transcription direction=POSITIVE}} |
− | {{#set: | + | {{#set: left end position=307}} |
− | {{#set: | + | {{#set: centisome position=1.9429151 }} |
− | {{#set: | + | {{#set: reaction associated=1.1.4.1-RXN}} |
− | + |
Revision as of 16:55, 21 March 2018
Gene Tiso_gene_11760
- right end position:
- 1254
- transcription direction:
- POSITIVE
- left end position:
- 307
- centisome position:
- 1.9429151
- Synonym(s):
Reactions associated
- Reaction: 1.1.4.1-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation