Difference between revisions of "TRANSENOYLCOARED-RXN"

Revision as of 16:55, 21 March 2018

@@ Line 1: / Line 1: @@
-[[Category:Metabolite]]
+[[Category:Gene]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] ==
+== Gene Tiso_gene_11760 ==
-* smiles:
+* right end position:
-** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
+** 1254
-* inchi key:
+* transcription direction:
-** InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L
+** POSITIVE
-* common name:
+* left end position:
-** 3-isopropyl-10-(methylthio)-2-oxodecanoate
+** 307
-* molecular weight:
+* centisome position:
-** 274.331
+** 1.9429151
 * Synonym(s):
-== Reaction(s) known to consume the compound ==
+== Reactions associated ==
-* [[RXN-18201]]
+* Reaction: [[1.1.4.1-RXN]]
-== Reaction(s) known to produce the compound ==
+** Source: [[annotation-in-silico_annotation]]
-== Reaction(s) of unknown directionality ==
+*** Assignment: ec-number
-* [[RXN-18200]]
+== Pathways associated ==
 == External links  ==
-{{#set: smiles=CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}}
+{{#set: right end position=1254}}
-{{#set: inchi key=InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L}}
+{{#set: transcription direction=POSITIVE}}
-{{#set: common name=3-isopropyl-10-(methylthio)-2-oxodecanoate}}
+{{#set: left end position=307}}
-{{#set: molecular weight=274.331    }}
+{{#set: centisome position=1.9429151    }}
-{{#set: consumed by=RXN-18201}}
+{{#set: reaction associated=1.1.4.1-RXN}}
-{{#set: reversible reaction associated=RXN-18200}}