Difference between revisions of "TRIOSEPISOMERIZATION-RXN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-101 TRANS-RXN-101] == * direction: ** LEFT-TO-RIGHT * common name: ** Sodium:proton antip...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIT CIT] == * smiles: ** C(=O)([O-])CC(C(=O)[O-])(O)CC(=O)[O-] * common name: ** citrate * inch...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIT CIT] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])CC(C(=O)[O-])(O)CC(=O)[O-] |
* common name: | * common name: | ||
− | ** | + | ** citrate |
+ | * inchi key: | ||
+ | ** InChIKey=KRKNYBCHXYNGOX-UHFFFAOYSA-K | ||
+ | * molecular weight: | ||
+ | ** 189.101 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** citr | ||
+ | ** cit | ||
+ | ** citric acid | ||
+ | ** 2-hydroxy-1,2,3-propanetricarboxylic acid | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[CSm]] | |
− | + | * [[CSx]] | |
− | + | * [[CITSYN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | = | + | * [[RXN-14047]] |
− | + | * [[OAACITtm]] | |
− | * [[ | + | * [[AKGCITtm]] |
− | + | * [[ACONITATEDEHYDR-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 77-92-9 |
− | {{#set: common name= | + | * BIGG : cit |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=31348 31348] |
− | {{#set: | + | * KNAPSACK : C00007619 |
− | {{#set: | + | * HMDB : HMDB00094 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00158 C00158] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.29081.html 29081] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16947 16947] | ||
+ | * METABOLIGHTS : MTBLC16947 | ||
+ | {{#set: smiles=C(=O)([O-])CC(C(=O)[O-])(O)CC(=O)[O-]}} | ||
+ | {{#set: common name=citrate}} | ||
+ | {{#set: inchi key=InChIKey=KRKNYBCHXYNGOX-UHFFFAOYSA-K}} | ||
+ | {{#set: molecular weight=189.101 }} | ||
+ | {{#set: common name=citr|cit|citric acid|2-hydroxy-1,2,3-propanetricarboxylic acid}} | ||
+ | {{#set: produced by=CSm|CSx|CITSYN-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-14047|OAACITtm|AKGCITtm|ACONITATEDEHYDR-RXN}} |
Revision as of 16:31, 21 March 2018
Contents
Metabolite CIT
- smiles:
- C(=O)([O-])CC(C(=O)[O-])(O)CC(=O)[O-]
- common name:
- citrate
- inchi key:
- InChIKey=KRKNYBCHXYNGOX-UHFFFAOYSA-K
- molecular weight:
- 189.101
- Synonym(s):
- citr
- cit
- citric acid
- 2-hydroxy-1,2,3-propanetricarboxylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 77-92-9
- BIGG : cit
- PUBCHEM:
- KNAPSACK : C00007619
- HMDB : HMDB00094
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC16947
"C(=O)([O-])CC(C(=O)[O-])(O)CC(=O)[O-" cannot be used as a page name in this wiki.