Difference between revisions of "TUBULIN-N-ACETYLTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYMALTOPHOSPHORYL-RXN GLYMALTOPHOSPHORYL-RXN] == * direction: ** REVERSIBLE * common name: ** thym...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1325 RXN1G-1325] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis,cis-delt...") |
||
Line 1: | Line 1: | ||
[[Category:Reaction]] | [[Category:Reaction]] | ||
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object= | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1325 RXN1G-1325] == |
* direction: | * direction: | ||
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** trans-delta2-cis,cis-delta15,33-C52:3-[acyl-carrier protein] reductase (NADPH, B-specific) |
* ec number: | * ec number: | ||
− | ** [http://enzyme.expasy.org/EC/ | + | ** [http://enzyme.expasy.org/EC/1.3.1.M4 EC-1.3.1.M4] |
* Synonym(s): | * Synonym(s): | ||
== Reaction Formula == | == Reaction Formula == | ||
* With identifiers: | * With identifiers: | ||
− | ** 1 [[ | + | ** 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[trans-D2-cis-cis-D15-33-C52-3-ACPs]][c] '''=>''' 1 [[cis-cis-D15-33-C52-2-ACPs]][c] '''+''' 1 [[NAD]][c] |
* With common name(s): | * With common name(s): | ||
− | ** 1 | + | ** 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 a trans-delta2-cis,cis-delta15,33-C52:3-[acp][c] '''=>''' 1 a cis,cis-delta15,33-C52:2-[acp][c] '''+''' 1 NAD+[c] |
== Genes associated with this reaction == | == Genes associated with this reaction == | ||
Genes have been associated with this reaction based on different elements listed below. | Genes have been associated with this reaction based on different elements listed below. | ||
− | * [[ | + | * [[Tiso_gene_10778]] |
− | ** | + | ** [[pantograph]]-[[esiliculosus]] |
− | + | ||
== Pathways == | == Pathways == | ||
+ | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | ||
+ | ** '''86''' reactions found over '''182''' reactions in the full pathway | ||
== Reconstruction information == | == Reconstruction information == | ||
− | * [[ | + | * [[orthology]]: |
− | ** [[ | + | ** [[pantograph]]: |
− | *** [[ | + | *** [[esiliculosus]] |
== External links == | == External links == | ||
− | {{#set: direction= | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: common name= | + | {{#set: common name=trans-delta2-cis,cis-delta15,33-C52:3-[acyl-carrier protein] reductase (NADPH, B-specific)}} |
− | {{#set: ec number=EC- | + | {{#set: ec number=EC-1.3.1.M4}} |
− | {{#set: gene associated= | + | {{#set: gene associated=Tiso_gene_10778}} |
− | {{#set: in pathway=}} | + | {{#set: in pathway=PWYG-321}} |
− | {{#set: reconstruction category= | + | {{#set: reconstruction category=orthology}} |
− | {{#set: reconstruction tool= | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: reconstruction source= | + | {{#set: reconstruction source=esiliculosus}} |
Revision as of 17:54, 10 January 2018
Contents
Reaction RXN1G-1325
- direction:
- LEFT-TO-RIGHT
- common name:
- trans-delta2-cis,cis-delta15,33-C52:3-[acyl-carrier protein] reductase (NADPH, B-specific)
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADH[c] + 1 PROTON[c] + 1 trans-D2-cis-cis-D15-33-C52-3-ACPs[c] => 1 cis-cis-D15-33-C52-2-ACPs[c] + 1 NAD[c]
- With common name(s):
- 1 NADH[c] + 1 H+[c] + 1 a trans-delta2-cis,cis-delta15,33-C52:3-[acp][c] => 1 a cis,cis-delta15,33-C52:2-[acp][c] + 1 NAD+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
External links
"trans-delta2-cis,cis-delta15,33-C52:3-[acyl-carrier protein] reductase (NADPH, B-specific)" cannot be used as a page name in this wiki.