Difference between revisions of "Tiso gene 1006"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] == * smiles: ** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O * inchi key: *...")
(Created page with "Category:Gene == Gene Tiso_gene_1006 == * Synonym(s): == Reactions associated == * Reaction: BFFS ** Source: orthology-creinhardtii * Reaction: RFH ** Source:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] ==
+
== Gene Tiso_gene_1006 ==
* smiles:
+
** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O
+
* inchi key:
+
** InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M
+
* common name:
+
** γ-L-glutamyl-glycylglycine
+
* molecular weight:
+
** 260.226   
+
 
* Synonym(s):
 
* Synonym(s):
** γ-L-Glu-Gly-Gly
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[BFFS]]
* [[RXN-18092]]
+
** Source: [[orthology-creinhardtii]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RFH]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O}}
+
{{#set: reaction associated=BFFS|RFH}}
{{#set: inchi key=InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M}}
+
{{#set: common name=γ-L-glutamyl-glycylglycine}}
+
{{#set: molecular weight=260.226    }}
+
{{#set: common name=γ-L-Glu-Gly-Gly}}
+
{{#set: produced by=RXN-18092}}
+

Latest revision as of 20:31, 21 March 2018

Gene Tiso_gene_1006

  • Synonym(s):

Reactions associated

Pathways associated

External links