Difference between revisions of "Tiso gene 10094"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] == * smiles: ** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...")
(Created page with "Category:Gene == Gene Tiso_gene_10094 == * right end position: ** 3101 * transcription direction: ** POSITIVE * left end position: ** 1299 * centisome position: ** 14.7212...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] ==
+
== Gene Tiso_gene_10094 ==
−
* smiles:
+
* right end position:
−
** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)
+
** 3101
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** XLLG xyloglucan oligosaccharide
+
** 1299
−
* molecular weight:
+
* centisome position:
−
** 1387.215    
+
** 14.721214    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12400]]
+
* Reaction: [[1.14.13.8-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN66-81]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY66-201]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3101}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940189 52940189]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)}}
+
{{#set: left end position=1299}}
−
{{#set: inchi key=InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N}}
+
{{#set: centisome position=14.721214    }}
−
{{#set: common name=XLLG xyloglucan oligosaccharide}}
+
{{#set: reaction associated=1.14.13.8-RXN|RXN66-81}}
−
{{#set: molecular weight=1387.215    }}
+
{{#set: pathway associated=PWY66-201}}
−
{{#set: consumed by=RXN-12400}}
+

Latest revision as of 21:14, 21 March 2018

Gene Tiso_gene_10094

  • right end position:
    • 3101
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1299
  • centisome position:
    • 14.721214
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10094&oldid=47093"