Difference between revisions of "Tiso gene 10315"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] == * smiles: ** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2)) * commo...") |
(Created page with "Category:Gene == Gene Tiso_gene_10315 == * right end position: ** 7874 * transcription direction: ** NEGATIVE * left end position: ** 5326 * centisome position: ** 49.3011...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10315 == |
− | * | + | * right end position: |
− | ** | + | ** 7874 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 5326 |
− | * | + | * centisome position: |
− | ** | + | ** 49.30112 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | + | *** Assignment: automated-name-match | |
− | + | == Pathways associated == | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
== External links == | == External links == | ||
− | + | {{#set: right end position=7874}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=5326}} | |
− | + | {{#set: centisome position=49.30112 }} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 21:25, 21 March 2018
Gene Tiso_gene_10315
- right end position:
- 7874
- transcription direction:
- NEGATIVE
- left end position:
- 5326
- centisome position:
- 49.30112
- Synonym(s):
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation