Difference between revisions of "Tiso gene 10355"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR] == * smiles: ** C(C2(C(O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-27 RXN66-27] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-27 RXN66-27] ==
−
* smiles:
+
* direction:
−
** C(C2(C(O)C(O)C(NC1(=C(N)C(=O)NC(=N1)N))O2))OP(=O)([O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=OCLCLRXKNJCOJD-UMMCILCDSA-L
+
** [http://enzyme.expasy.org/EC/1.3.1.21 EC-1.3.1.21]
−
* common name:
+
−
** 2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one
+
−
* molecular weight:
+
−
** 351.212   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine
 
−
** DARP
 
−
** 2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
 
−
** 2,5-diamino-6-(ribosylamino)-4-(3H)-pyrimidinone 5'-phosphate
 
−
** 2,5-diamino-6-(D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RIBOFLAVINSYNDEAM-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-8646]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[DESMOSTEROL-CPD]][c] '''+''' 1 [[NADP]][c]
−
* [[GTP-CYCLOHYDRO-II-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 7-dehydrodesmosterol[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 desmosterol[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_8982]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4]
 +
** '''7''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244331 25244331]
+
{{#set: ec number=EC-1.3.1.21}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_8982}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29114 29114]
+
{{#set: in pathway=PWY66-4}}
−
* BIGG : 25drapp
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01304 C01304]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C(C2(C(O)C(O)C(NC1(=C(N)C(=O)NC(=N1)N))O2))OP(=O)([O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=OCLCLRXKNJCOJD-UMMCILCDSA-L}}
+
−
{{#set: common name=2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one}}
+
−
{{#set: molecular weight=351.212    }}
+
−
{{#set: common name=2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine|DARP|2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate|2,5-diamino-6-(ribosylamino)-4-(3H)-pyrimidinone 5'-phosphate|2,5-diamino-6-(D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate}}
+
−
{{#set: consumed by=RIBOFLAVINSYNDEAM-RXN}}
+
−
{{#set: produced by=GTP-CYCLOHYDRO-II-RXN}}
+

Revision as of 19:39, 18 March 2018

Reaction RXN66-27

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 7-dehydrodesmosterol[c] + 1 NADPH[c] + 1 H+[c] => 1 desmosterol[c] + 1 NADP+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-4, cholesterol biosynthesis III (via desmosterol): PWY66-4
    • 7 reactions found over 22 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10355&oldid=25878"