Difference between revisions of "Tiso gene 10528"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] == * smiles: ** CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Tiso_gene_10528 == * right end position: ** 8404 * transcription direction: ** POSITIVE * left end position: ** 5895 * centisome position: ** 69.7055...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10528 == |
− | * | + | * right end position: |
− | ** | + | ** 8404 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 5895 |
− | * | + | * centisome position: |
− | ** | + | ** 69.70557 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ALCOHOL-O-ACETYLTRANSFERASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[RXN- | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[RXN-12362]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | * [[ | + | * Reaction: [[RXN-12363]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | * Reaction: [[RXN-9192]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
+ | * [[PWY-5835]] | ||
+ | * [[PWY-6801]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=8404}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=5895}} | |
− | + | {{#set: centisome position=69.70557 }} | |
− | + | {{#set: reaction associated=ALCOHOL-O-ACETYLTRANSFERASE-RXN|RXN-12362|RXN-12363|RXN-9192}} | |
− | + | {{#set: pathway associated=PWY-5835|PWY-6801}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 20:57, 21 March 2018
Gene Tiso_gene_10528
- right end position:
- 8404
- transcription direction:
- POSITIVE
- left end position:
- 5895
- centisome position:
- 69.70557
- Synonym(s):
Reactions associated
- Reaction: ALCOHOL-O-ACETYLTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-12362
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-12363
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-9192
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation