Difference between revisions of "Tiso gene 10591"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * smiles: ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] * inchi key: ** InCh...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13158 RXN-13158] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-isopropylmalate dehydroge...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13158 RXN-13158] ==
−
* smiles:
+
* direction:
−
** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K
+
 
* common name:
 
* common name:
−
** carboxyphosphinopyruvate
+
** 3-isopropylmalate dehydrogenase
−
* molecular weight:
+
* ec number:
−
** 193.029   
+
** [http://enzyme.expasy.org/EC/1.1.1.85 EC-1.1.1.85]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10828]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[2K-4CH3-PENTANOATE]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
* [[RXN-10827]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 (2R,3S)-3-isopropylmalate[c] '''+''' 1 NAD+[c] '''=>''' 1 4-methyl-2-oxopentanoate[c] '''+''' 1 NADH[c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_2920]]
 +
** EXPERIMENTAL_ANNOTATION
 +
***EC-NUMBER
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479707 45479707]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32272 32272]
−
{{#set: smiles=C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K}}
+
{{#set: common name=3-isopropylmalate dehydrogenase}}
−
{{#set: common name=carboxyphosphinopyruvate}}
+
{{#set: ec number=EC-1.1.1.85}}
−
{{#set: molecular weight=193.029    }}
+
{{#set: gene associated=Tiso_gene_2920}}
−
{{#set: consumed by=RXN-10828}}
+
{{#set: in pathway=}}
−
{{#set: produced by=RXN-10827}}
+
{{#set: reconstruction category=orthology|manual|annotation}}
 +
{{#set: reconstruction source=manual-primary_network|annotation-experimental_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 19:50, 18 March 2018

Reaction RXN-13158

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-isopropylmalate dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10591&oldid=27249"