Difference between revisions of "Tiso gene 10634"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == * smiles: ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_10634 == * right end position: ** 6792 * transcription direction: ** POSITIVE * left end position: ** 5670 * centisome position: ** 46.1425...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10634 == |
− | * | + | * right end position: |
− | ** | + | ** 6792 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 5670 |
− | * | + | * centisome position: |
− | ** | + | ** 46.14258 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[SERINE-O-ACETTRAN-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[CYSTSYN-PWY]] | ||
+ | * [[PWY-7274]] | ||
+ | * [[PWY-6936]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=6792}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=5670}} | |
− | + | {{#set: centisome position=46.14258 }} | |
− | + | {{#set: reaction associated=SERINE-O-ACETTRAN-RXN}} | |
− | + | {{#set: pathway associated=CYSTSYN-PWY|PWY-7274|PWY-6936}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:09, 21 March 2018
Gene Tiso_gene_10634
- right end position:
- 6792
- transcription direction:
- POSITIVE
- left end position:
- 5670
- centisome position:
- 46.14258
- Synonym(s):
Reactions associated
- Reaction: SERINE-O-ACETTRAN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation