Difference between revisions of "Tiso gene 10743"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4101 PWY-4101] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * smiles: ** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4)) *...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4101 PWY-4101] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* inchi key:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-71275 TAX-71275]
+
** InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N
 
* common name:
 
* common name:
−
** D-sorbitol degradation I
+
** pregn-5-ene-3,20-dione-17-ol
 +
* molecular weight:
 +
** 330.466   
 
* Synonym(s):
 
* Synonym(s):
−
** sorbitol utilization
 
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
* '''3''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
−
** [[RXN-7644]]
+
== Reaction(s) of unknown directionality ==
−
** [[FRUCTOKINASE-RXN]]
+
* [[RXN66-350]]
−
** [[RXN-14515]]
+
−
== Reaction(s) not found ==
+
−
* '''0''' reaction(s) not found
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-4751}}
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14562950 14562950]
−
{{#set: taxonomic range=TAX-71275}}
+
{{#set: smiles=CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))}}
−
{{#set: common name=D-sorbitol degradation I}}
+
{{#set: inchi key=InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N}}
−
{{#set: common name=sorbitol utilization}}
+
{{#set: common name=pregn-5-ene-3,20-dione-17-ol}}
−
{{#set: reaction found=3}}
+
{{#set: molecular weight=330.466    }}
−
{{#set: reaction not found=0}}
+
{{#set: consumed or produced by=RXN66-350}}

Revision as of 16:40, 10 January 2018

Metabolite CPD66-27

  • smiles:
    • CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))
  • inchi key:
    • InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N
  • common name:
    • pregn-5-ene-3,20-dione-17-ol
  • molecular weight:
    • 330.466
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10743&oldid=9964"