Difference between revisions of "Tiso gene 10793"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == * smiles: ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) * inchi key: ** InChIKe...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7396 PWY-7396] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
* inchi key:
 +
** InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** butanol and isobutanol biosynthesis (engineered)
+
** 2-carboxy-L-xylonolactone
 +
* molecular weight:
 +
** 191.117   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''4''' reactions found over '''8''' reactions in the full pathway
+
* [[RXN-12871]]
−
* [[1.4.3.19-RXN]]
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-14986]]
+
* [[RXN-12870]]
−
* [[RXN-161]]
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-7657]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=3-ETHYLMALATE-SYNTHASE-RXN 3-ETHYLMALATE-SYNTHASE-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14984 RXN-14984]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14985 RXN-14985]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7643 RXN-7643]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-4751}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658445 90658445]
−
{{#set: common name=butanol and isobutanol biosynthesis (engineered)}}
+
{{#set: smiles=C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)}}
−
{{#set: reaction found=4}}
+
{{#set: inchi key=InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M}}
−
{{#set: reaction not found=8}}
+
{{#set: common name=2-carboxy-L-xylonolactone}}
−
{{#set: completion rate=50.0}}
+
{{#set: molecular weight=191.117    }}
 +
{{#set: consumed by=RXN-12871}}
 +
{{#set: produced by=RXN-12870}}

Revision as of 19:06, 18 March 2018

Metabolite CPD-13913

  • smiles:
    • C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)
  • inchi key:
    • InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M
  • common name:
    • 2-carboxy-L-xylonolactone
  • molecular weight:
    • 191.117
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10793&oldid=21908"