Difference between revisions of "Tiso gene 10793"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == * smiles: ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Tiso_gene_10793 == * right end position: ** 5834 * transcription direction: ** POSITIVE * left end position: ** 2380 * centisome position: ** 28.7127...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10793 == |
− | * | + | * right end position: |
− | ** | + | ** 5834 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 2380 |
− | * | + | * centisome position: |
− | ** | + | ** 28.712753 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.7.11.24-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: right end position=5834}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: left end position=2380}} |
− | {{#set: | + | {{#set: centisome position=28.712753 }} |
− | {{#set: | + | {{#set: reaction associated=2.7.11.24-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:20, 21 March 2018
Gene Tiso_gene_10793
- right end position:
- 5834
- transcription direction:
- POSITIVE
- left end position:
- 2380
- centisome position:
- 28.712753
- Synonym(s):
Reactions associated
- Reaction: 2.7.11.24-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation