Difference between revisions of "Tiso gene 10799"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE-5P PYRIDOXAMINE-5P] == * smiles: ** CC1(C(=C(C(COP([O-])([O-])=O)=CN=1)C[N+])O) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_10799 == * right end position: ** 4919 * transcription direction: ** POSITIVE * left end position: ** 3650 * centisome position: ** 27.6536...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10799 == |
− | * | + | * right end position: |
− | ** | + | ** 4919 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 3650 |
− | * | + | * centisome position: |
− | ** | + | ** 27.65361 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[6PGLUCONOLACT-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | == Pathways associated == |
− | + | * [[P122-PWY]] | |
+ | * [[RUMP-PWY]] | ||
+ | * [[OXIDATIVEPENT-PWY]] | ||
+ | * [[GLYCOLYSIS-E-D]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4919}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=3650}} | |
− | + | {{#set: centisome position=27.65361 }} | |
− | + | {{#set: reaction associated=6PGLUCONOLACT-RXN}} | |
− | + | {{#set: pathway associated=P122-PWY|RUMP-PWY|OXIDATIVEPENT-PWY|GLYCOLYSIS-E-D}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:56, 21 March 2018
Gene Tiso_gene_10799
- right end position:
- 4919
- transcription direction:
- POSITIVE
- left end position:
- 3650
- centisome position:
- 27.65361
- Synonym(s):
Reactions associated
- Reaction: 6PGLUCONOLACT-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation