Difference between revisions of "Tiso gene 10922"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=RGH...") |
(Created page with "Category:Gene == Gene Tiso_gene_10922 == * right end position: ** 1783 * transcription direction: ** POSITIVE * left end position: ** 402 * centisome position: ** 3.791022...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10922 == |
− | * | + | * right end position: |
− | ** | + | ** 1783 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 402 |
− | * | + | * centisome position: |
− | ** | + | ** 3.7910223 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1.13.11.6-RXN]] | |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | == Pathways associated == |
+ | * [[PWY-5651]] | ||
+ | * [[PWY-6505]] | ||
+ | * [[PWY-6309]] | ||
+ | * [[PWY-5647]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1783}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=402}} | |
− | + | {{#set: centisome position=3.7910223 }} | |
− | + | {{#set: reaction associated=1.13.11.6-RXN}} | |
− | + | {{#set: pathway associated=PWY-5651|PWY-6505|PWY-6309|PWY-5647}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:10, 21 March 2018
Gene Tiso_gene_10922
- right end position:
- 1783
- transcription direction:
- POSITIVE
- left end position:
- 402
- centisome position:
- 3.7910223
- Synonym(s):
Reactions associated
- Reaction: 1.13.11.6-RXN
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation