Difference between revisions of "Tiso gene 11148"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_11559 == * left end position: ** 331 * transcription direction: ** POSITIVE * right end position: ** 3431 * centisome position: ** 4.291455...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] == * smiles: ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C |
| − | * | + | * common name: |
| − | ** | + | ** β-D-mannosyl-(C55 ω-saturated dolichyl phosphate) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=MBYVKTIIZNUHKN-NIVAAIEQSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1012.461 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-16602]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820528 91820528] |
| − | {{#set: | + | {{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C}} |
| − | {{#set: | + | {{#set: common name=β-D-mannosyl-(C55 ω-saturated dolichyl phosphate)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=MBYVKTIIZNUHKN-NIVAAIEQSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=1012.461 }} |
| + | {{#set: produced by=RXN-16602}} | ||
Revision as of 17:05, 21 March 2018
Contents
Metabolite CPD-17894
- smiles:
- CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C
- common name:
- β-D-mannosyl-(C55 ω-saturated dolichyl phosphate)
- inchi key:
- InChIKey=MBYVKTIIZNUHKN-NIVAAIEQSA-M
- molecular weight:
- 1012.461
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C" cannot be used as a page name in this wiki.
