Difference between revisions of "Tiso gene 11251"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-5P PYRIDOXINE-5P] == * smiles: ** CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO) * inchi k...")
(Created page with "Category:Gene == Gene Tiso_gene_11251 == * right end position: ** 4108 * transcription direction: ** NEGATIVE * left end position: ** 405 * centisome position: ** 5.107832...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-5P PYRIDOXINE-5P] ==
+
== Gene Tiso_gene_11251 ==
−
* smiles:
+
* right end position:
−
** CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO)
+
** 4108
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WHOMFKWHIQZTHY-UHFFFAOYSA-L
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** pyridoxine 5'-phosphate
+
** 405
−
* molecular weight:
+
* centisome position:
−
** 247.144    
+
** 5.107832    
 
* Synonym(s):
 
* Synonym(s):
−
** pyridoxol 5'-phosphate
 
−
** pyridoxine 5-phosphate
 
−
** pyridoxine phosphate
 
−
** pyridoxine-5P
 
−
** pyridoxine-P
 
−
** [5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[PNPOXI-RXN]]
+
* Reaction: [[DNA-LIGASE-ATP-RXN]]
−
* [[RXN-14181]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: ec-number
−
* [[PNKIN-RXN]]
+
** Source: [[orthology-esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-17917]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17918]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17919]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 447-05-2
+
{{#set: right end position=4108}}
−
* METABOLIGHTS : MTBLC58589
+
{{#set: transcription direction=NEGATIVE}}
−
* PUBCHEM:
+
{{#set: left end position=405}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24794348 24794348]
+
{{#set: centisome position=5.107832   }}
−
* HMDB : HMDB01319
+
{{#set: reaction associated=DNA-LIGASE-ATP-RXN|RXN-17917|RXN-17918|RXN-17919}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00627 C00627]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58589 58589]
+
−
* BIGG : pdx5p
+
−
{{#set: smiles=CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO)}}
+
−
{{#set: inchi key=InChIKey=WHOMFKWHIQZTHY-UHFFFAOYSA-L}}
+
−
{{#set: common name=pyridoxine 5'-phosphate}}
+
−
{{#set: molecular weight=247.144   }}
+
−
{{#set: common name=pyridoxol 5'-phosphate|pyridoxine 5-phosphate|pyridoxine phosphate|pyridoxine-5P|pyridoxine-P|[5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl phosphate}}
+
−
{{#set: consumed by=PNPOXI-RXN|RXN-14181}}
+
−
{{#set: produced by=PNKIN-RXN}}
+

Latest revision as of 21:10, 21 March 2018

Gene Tiso_gene_11251

  • right end position:
    • 4108
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 405
  • centisome position:
    • 5.107832
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11251&oldid=46514"