Difference between revisions of "Tiso gene 11297"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_9325 == * left end position: ** 2353 * transcription direction: ** POSITIVE * right end position: ** 4912 * centisome position: ** 24.97611...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_9325 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] ==
−
* left end position:
+
* smiles:
−
** 2353
+
** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N
−
* right end position:
+
* common name:
−
** 4912
+
** dehydroascorbate (bicyclic form)
−
* centisome position:
+
* molecular weight:
−
** 24.976118    
+
** 192.125    
 
* Synonym(s):
 
* Synonym(s):
 +
** dehydroascorbate monohydrate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[R468-RXN]]
+
* [[RXN-12861]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[RXN-12862]]
−
** experimental_annotation
+
== Reaction(s) of unknown directionality ==
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-5169]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2353}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659000 90659000]
−
{{#set: right end position=4912}}
+
{{#set: smiles=C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))}}
−
{{#set: centisome position=24.976118   }}
+
{{#set: inchi key=InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N}}
−
{{#set: reaction associated=R468-RXN}}
+
{{#set: common name=dehydroascorbate (bicyclic form)}}
−
{{#set: pathway associated=PWY-5169}}
+
{{#set: molecular weight=192.125   }}
 +
{{#set: common name=dehydroascorbate monohydrate}}
 +
{{#set: consumed by=RXN-12861}}
 +
{{#set: produced by=RXN-12862}}

Revision as of 17:36, 10 January 2018

Metabolite CPD-13907

  • smiles:
    • C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))
  • inchi key:
    • InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N
  • common name:
    • dehydroascorbate (bicyclic form)
  • molecular weight:
    • 192.125
  • Synonym(s):
    • dehydroascorbate monohydrate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11297&oldid=13704"