Difference between revisions of "Tiso gene 11297"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Tiso_gene_11297 == * right end position: ** 7171 * transcription direction: ** NEGATIVE * left end position: ** 4785 * centisome position: ** 60.6079...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_11297 == |
− | * | + | * right end position: |
− | ** | + | ** 7171 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 4785 |
− | * | + | * centisome position: |
− | ** | + | ** 60.607983 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[HISTCYCLOHYD-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[RXN- | + | *** Assignment: automated-name-match |
− | == | + | ** Source: [[orthology-athaliana]] |
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[HISTPRATPHYD-RXN]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[PRACH]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[PRADP]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[HISTSYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=7171}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | {{#set: | + | {{#set: left end position=4785}} |
− | {{#set: | + | {{#set: centisome position=60.607983 }} |
− | {{#set: | + | {{#set: reaction associated=HISTCYCLOHYD-RXN|HISTPRATPHYD-RXN|PRACH|PRADP}} |
− | {{#set: | + | {{#set: pathway associated=HISTSYN-PWY}} |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:43, 21 March 2018
Gene Tiso_gene_11297
- right end position:
- 7171
- transcription direction:
- NEGATIVE
- left end position:
- 4785
- centisome position:
- 60.607983
- Synonym(s):
Reactions associated
- Reaction: HISTCYCLOHYD-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Reaction: HISTPRATPHYD-RXN
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Reaction: PRACH
- Source: orthology-creinhardtii
- Reaction: PRADP
- Source: orthology-creinhardtii