Difference between revisions of "Tiso gene 11396"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYAMPP PYAMPP] == * direction: ** LEFT-TO-RIGHT * common name: ** Pyridoxamine-5'-phosphate phospho...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYAMPP PYAMPP] ==
−
* smiles:
+
* direction:
−
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M
+
 
* common name:
 
* common name:
−
** adenosine 5'-phosphoselenate
+
** Pyridoxamine-5'-phosphate phosphohydrolase
−
* molecular weight:
+
−
** 473.174   
+
 
* Synonym(s):
 
* Synonym(s):
−
** adenylyl-selenate
 
−
** APSe
 
−
** adenosine phosphoselenate
 
−
** adenylylselenate
 
−
** adenosine-5'-phosphoselenate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-12720]]
+
** 1.0 [[WATER]][c] '''+''' 1.0 [[PYRIDOXAMINE-5P]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[PYRIDOXAMINE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 H2O[c] '''+''' 1.0 pyridoxamine 5'-phosphate[c] '''=>''' 1.0 phosphate[c] '''+''' 1.0 pyridoxamine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18054]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657723 90657723]
+
{{#set: common name=Pyridoxamine-5'-phosphate phosphohydrolase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_18054}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2485 2485]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05686 C05686]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
* HMDB : HMDB04112
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O}}
+
−
{{#set: inchi key=InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M}}
+
−
{{#set: common name=adenosine 5'-phosphoselenate}}
+
−
{{#set: molecular weight=473.174    }}
+
−
{{#set: common name=adenylyl-selenate|APSe|adenosine phosphoselenate|adenylylselenate|adenosine-5'-phosphoselenate}}
+
−
{{#set: produced by=RXN-12720}}
+

Revision as of 16:56, 21 March 2018

Reaction PYAMPP

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Pyridoxamine-5'-phosphate phosphohydrolase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H2O[c] + 1.0 pyridoxamine 5'-phosphate[c] => 1.0 phosphate[c] + 1.0 pyridoxamine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11396&oldid=37442"