Difference between revisions of "Tiso gene 11760"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HYDROG-RXN HYDROG-RXN] == * direction: ** REVERSIBLE * common name: ** cytosolic_fe-s_cluster_assem...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1117 RXN1G-1117] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis,cis-delt...") |
||
Line 1: | Line 1: | ||
[[Category:Reaction]] | [[Category:Reaction]] | ||
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object= | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1117 RXN1G-1117] == |
* direction: | * direction: | ||
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** trans-delta2-cis,cis-delta13,31-C50:3-[acyl-carrier protein] reductase |
* ec number: | * ec number: | ||
− | ** [http://enzyme.expasy.org/EC/1. | + | ** [http://enzyme.expasy.org/EC/1.3.1.M4 EC-1.3.1.M4] |
* Synonym(s): | * Synonym(s): | ||
== Reaction Formula == | == Reaction Formula == | ||
* With identifiers: | * With identifiers: | ||
− | ** 1 [[ | + | ** 1 [[trans-D2-cis-cis-D13-31-C50-3-ACPs]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[cis-cis-D13-31-C50-2-ACPs]][c] |
* With common name(s): | * With common name(s): | ||
− | ** 1 | + | ** 1 a trans-delta2-cis,cis-delta13,31-C50:3-[acp][c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''=>''' 1 NAD+[c] '''+''' 1 a cis,cis-delta13,31-C50:2-[acp][c] |
== Genes associated with this reaction == | == Genes associated with this reaction == | ||
Genes have been associated with this reaction based on different elements listed below. | Genes have been associated with this reaction based on different elements listed below. | ||
− | * [[ | + | * [[Tiso_gene_10778]] |
− | + | ||
− | + | ||
** [[pantograph]]-[[esiliculosus]] | ** [[pantograph]]-[[esiliculosus]] | ||
== Pathways == | == Pathways == | ||
− | * [[ | + | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] |
− | ** ''' | + | ** '''86''' reactions found over '''182''' reactions in the full pathway |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reconstruction information == | == Reconstruction information == | ||
* [[orthology]]: | * [[orthology]]: | ||
** [[pantograph]]: | ** [[pantograph]]: | ||
*** [[esiliculosus]] | *** [[esiliculosus]] | ||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=trans-delta2-cis,cis-delta13,31-C50:3-[acyl-carrier protein] reductase}} | |
− | + | {{#set: ec number=EC-1.3.1.M4}} | |
− | + | {{#set: gene associated=Tiso_gene_10778}} | |
− | + | {{#set: in pathway=PWYG-321}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: direction= | + | |
− | {{#set: common name= | + | |
− | {{#set: ec number=EC-1. | + | |
− | {{#set: gene associated= | + | |
− | {{#set: in pathway= | + | |
{{#set: reconstruction category=orthology}} | {{#set: reconstruction category=orthology}} | ||
{{#set: reconstruction tool=pantograph}} | {{#set: reconstruction tool=pantograph}} | ||
{{#set: reconstruction source=esiliculosus}} | {{#set: reconstruction source=esiliculosus}} | ||
− | |||
− | |||
− |
Revision as of 18:17, 10 January 2018
Contents
Reaction RXN1G-1117
- direction:
- LEFT-TO-RIGHT
- common name:
- trans-delta2-cis,cis-delta13,31-C50:3-[acyl-carrier protein] reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 trans-D2-cis-cis-D13-31-C50-3-ACPs[c] + 1 NADH[c] + 1 PROTON[c] => 1 NAD[c] + 1 cis-cis-D13-31-C50-2-ACPs[c]
- With common name(s):
- 1 a trans-delta2-cis,cis-delta13,31-C50:3-[acp][c] + 1 NADH[c] + 1 H+[c] => 1 NAD+[c] + 1 a cis,cis-delta13,31-C50:2-[acp][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
External links
"trans-delta2-cis,cis-delta13,31-C50:3-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.