Difference between revisions of "Tiso gene 11760"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
(Created page with "Category:Gene == Gene Tiso_gene_11760 == * right end position: ** 1254 * transcription direction: ** POSITIVE * left end position: ** 307 * centisome position: ** 1.942915...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] ==
+
== Gene Tiso_gene_11760 ==
−
* smiles:
+
* right end position:
−
** CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
+
** 1254
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** OPC4-3-hydroxyacyl-CoA
+
** 307
−
* molecular weight:
+
* centisome position:
−
** 999.813    
+
** 1.9429151    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10703]]
+
* Reaction: [[1.1.4.1-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-10705]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=1254}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237301 44237301]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
+
{{#set: left end position=307}}
−
{{#set: inchi key=InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J}}
+
{{#set: centisome position=1.9429151   }}
−
{{#set: common name=OPC4-3-hydroxyacyl-CoA}}
+
{{#set: reaction associated=1.1.4.1-RXN}}
−
{{#set: molecular weight=999.813   }}
+
−
{{#set: consumed by=RXN-10703}}
+
−
{{#set: produced by=RXN-10705}}
+

Latest revision as of 21:12, 21 March 2018

Gene Tiso_gene_11760

  • right end position:
    • 1254
  • transcription direction:
    • POSITIVE
  • left end position:
    • 307
  • centisome position:
    • 1.9429151
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11760&oldid=46824"