Difference between revisions of "Tiso gene 11850"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)=O) * inchi key: ** InChIKey...")
 
(Created page with "Category:Gene == Gene Tiso_gene_11850 == * right end position: ** 7441 * transcription direction: ** NEGATIVE * left end position: ** 5768 * centisome position: ** 77.1019...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] ==
+
== Gene Tiso_gene_11850 ==
−
* smiles:
+
* right end position:
−
** C(O)C1(OC(C(C(C1O)O)O)=O)
+
** 7441
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** D-glucono-1,5-lactone
+
** 5768
−
* molecular weight:
+
* centisome position:
−
** 178.141    
+
** 77.10199    
 
* Synonym(s):
 
* Synonym(s):
−
** 3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one
 
−
** gluconolactone
 
−
** glucono-1,5-lactone
 
−
** 1,5-gluconolactone
 
−
** D-gluconolactone
 
−
** glucono-δ-lactone
 
−
** δ-gluconolactone
 
−
** D-glucono-δ-lactone
 
−
** gluconic lactone
 
−
** gluconic acid lactone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[GLUCONOLACT-RXN]]
+
* Reaction: [[2.1.1.143-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
−
* [[RXN-11334]]
+
* Reaction: [[RXN-4021]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-athaliana]]
 +
== Pathways associated ==
 +
* [[PWY-2541]]
 +
* [[PWY-7155]]
 
== External links  ==
 
== External links  ==
−
* CAS : 90-80-2
+
{{#set: right end position=7441}}
−
* DRUGBANK : DB04564
+
{{#set: transcription direction=NEGATIVE}}
−
* PUBCHEM:
+
{{#set: left end position=5768}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7027 7027]
+
{{#set: centisome position=77.10199   }}
−
* HMDB : HMDB00150
+
{{#set: reaction associated=2.1.1.143-RXN|RXN-4021}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-2541|PWY-7155}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00198 C00198]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.6760.html 6760]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16217 16217]
+
−
{{#set: smiles=C(O)C1(OC(C(C(C1O)O)O)=O)}}
+
−
{{#set: inchi key=InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N}}
+
−
{{#set: common name=D-glucono-1,5-lactone}}
+
−
{{#set: molecular weight=178.141   }}
+
−
{{#set: common name=3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one|gluconolactone|glucono-1,5-lactone|1,5-gluconolactone|D-gluconolactone|glucono-δ-lactone|δ-gluconolactone|D-glucono-δ-lactone|gluconic lactone|gluconic acid lactone}}
+
−
{{#set: consumed by=GLUCONOLACT-RXN}}
+
−
{{#set: consumed or produced by=RXN-11334}}
+

Latest revision as of 21:12, 21 March 2018

Gene Tiso_gene_11850

  • right end position:
    • 7441
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 5768
  • centisome position:
    • 77.10199
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11850&oldid=46810"