Difference between revisions of "Tiso gene 11980"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] == * smiles: ** CC(CC([N+])C([O-])=O)C * inchi key: ** InChIKey=ROHFNLRQFUQHCH-YFKPBYR...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2Fe-2S-proteins 2Fe-2S-proteins] == * common name: ** an [2Fe-2S] cluster protein * Synonym(s):...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2Fe-2S-proteins 2Fe-2S-proteins] ==
* smiles:
+
** CC(CC([N+])C([O-])=O)C
+
* inchi key:
+
** InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N
+
 
* common name:
 
* common name:
** L-leucine
+
** an [2Fe-2S] cluster protein
* molecular weight:
+
** 131.174   
+
 
* Synonym(s):
 
* Synonym(s):
** (2S)-α-2-amino-4-methylvaleric acid
+
** a holo-[2Fe-2S] cluster protein
** L
+
** leu
+
** leucine
+
** 2-amino-4-methylvaleric acid
+
** (2S)-α-leucine
+
** L-leu
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[LEUCINE--TRNA-LIGASE-RXN]]
 
* [[RME144]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14390]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
 
 
== External links  ==
 
== External links  ==
* NCI:
+
{{#set: common name=an [2Fe-2S] cluster protein}}
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=46709 46709]
+
{{#set: common name=a holo-[2Fe-2S] cluster protein}}
* CAS : 61-90-5
+
{{#set: produced by=RXN-14390}}
* METABOLIGHTS : MTBLC57427
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7045798 7045798]
+
* HMDB : HMDB00687
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00123 C00123]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57427 57427]
+
* BIGG : leu__L
+
{{#set: smiles=CC(CC([N+])C([O-])=O)C}}
+
{{#set: inchi key=InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N}}
+
{{#set: common name=L-leucine}}
+
{{#set: molecular weight=131.174    }}
+
{{#set: common name=(2S)-α-2-amino-4-methylvaleric acid|L|leu|leucine|2-amino-4-methylvaleric acid|(2S)-α-leucine|L-leu}}
+
{{#set: consumed by=LEUCINE--TRNA-LIGASE-RXN|RME144}}
+
{{#set: consumed or produced by=BRANCHED-CHAINAMINOTRANSFERLEU-RXN}}
+

Revision as of 17:36, 10 January 2018

Metabolite 2Fe-2S-proteins

  • common name:
    • an [2Fe-2S] cluster protein
  • Synonym(s):
    • a holo-[2Fe-2S] cluster protein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [2Fe-2S] cluster protein" cannot be used as a page name in this wiki.
"a holo-[2Fe-2S] cluster protein" cannot be used as a page name in this wiki.